C20H31NO3Si — CID 174639549
4,4-dimethyl-1-[[4-(2-oxo-1-trimethylsilylpropyl)phenyl]methyl]pyrrolidine-3-carboxylic acid (PubChem CID 174639549) has the molecular formula C20H31NO3Si and a molecular weight of 361.56 g/mol. Its IUPAC name is 4,4-dimethyl-1-[[4-(2-oxo-1-trimethylsilylpropyl)phenyl]methyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 4,4-dimethyl-1-[[4-(2-oxo-1-trimethylsilylpropyl)phenyl]methyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 174639549 |
| Molecular Formula | C20H31NO3Si |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 4,4-dimethyl-1-[[4-(2-oxo-1-trimethylsilylpropyl)phenyl]methyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC(=O)C(c1ccc(CN2CC(C(=O)O)C(C)(C)C2)cc1)[Si](C)(C)C |
| InChI | InChI=1S/C20H31NO3Si/c1-14(22)18(25(4,5)6)16-9-7-15(8-10-16)11-21-12-17(19(23)24)20(2,3)13-21/h7-10,17-18H,11-13H2,1-6H3,(H,23,24) |
| InChIKey | OSDZTQOPNHNFLX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|