C20H34N2O2Si — CID 175373957
[4-amino-1-[(4-methoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]-[tert-butyl(dimethyl)silyl]methanone (PubChem CID 175373957) has the molecular formula C20H34N2O2Si and a molecular weight of 362.59 g/mol. Its IUPAC name is [4-amino-1-[(4-methoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]-[tert-butyl(dimethyl)silyl]methanone.
| Compound Name | [4-amino-1-[(4-methoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]-[tert-butyl(dimethyl)silyl]methanone |
|---|---|
| PubChem CID | 175373957 |
| Molecular Formula | C20H34N2O2Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | [4-amino-1-[(4-methoxyphenyl)methyl]-4-methylpyrrolidin-3-yl]-[tert-butyl(dimethyl)silyl]methanone |
| SMILES | COc1ccc(CN2CC(C(=O)[Si](C)(C)C(C)(C)C)C(C)(N)C2)cc1 |
| InChI | InChI=1S/C20H34N2O2Si/c1-19(2,3)25(6,7)18(23)17-13-22(14-20(17,4)21)12-15-8-10-16(24-5)11-9-15/h8-11,17H,12-14,21H2,1-7H3 |
| InChIKey | IJWWMMRLZCQUCM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|