C16H20F3NO4 — CID 155854267
5-[(4-methoxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155854267) has the molecular formula C16H20F3NO4 and a molecular weight of 347.33 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(4-methoxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155854267 |
| Molecular Formula | C16H20F3NO4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 5-[(4-methoxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN2CC3COCC3C2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19NO2.C2HF3O2/c1-16-14-4-2-11(3-5-14)6-15-7-12-9-17-10-13(12)8-15;3-2(4,5)1(6)7/h2-5,12-13H,6-10H2,1H3;(H,6,7) |
| InChIKey | IUKQSMFDZOTXNM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |