C26H27F3N4O5 — CID 155836547
4-[(4-methoxyphenyl)methyl]-11-[(4-methylphenyl)methyl]-4,8,11,12-tetrazatricyclo[6.4.0.02,6]dodec-1(12)-ene-9,10-dione;2,2,2-trifluoroacetic acid (PubChem CID 155836547) has the molecular formula C26H27F3N4O5 and a molecular weight of 532.52 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)methyl]-11-[(4-methylphenyl)methyl]-4,8,11,12-tetrazatricyclo[6.4.0.02,6]dodec-1(12)-ene-9,10-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[(4-methoxyphenyl)methyl]-11-[(4-methylphenyl)methyl]-4,8,11,12-tetrazatricyclo[6.4.0.02,6]dodec-1(12)-ene-9,10-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155836547 |
| Molecular Formula | C26H27F3N4O5 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 4-[(4-methoxyphenyl)methyl]-11-[(4-methylphenyl)methyl]-4,8,11,12-tetrazatricyclo[6.4.0.02,6]dodec-1(12)-ene-9,10-dione;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN2CC3Cn4c(nn(Cc5ccc(C)cc5)c(=O)c4=O)C3C2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H26N4O3.C2HF3O2/c1-16-3-5-18(6-4-16)12-28-24(30)23(29)27-14-19-13-26(15-21(19)22(27)25-28)11-17-7-9-20(31-2)10-8-17;3-2(4,5)1(6)7/h3-10,19,21H,11-15H2,1-2H3;(H,6,7) |
| InChIKey | CDNOUQQMHYYJBM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|