C30H36F3N5O5 — CID 155840018
8-methyl-2-[(4-methylphenyl)methyl]-1'-[(4-propan-2-yloxyphenyl)methyl]spiro[6H-imidazo[2,1-c][1,2,4]triazine-7,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 155840018) has the molecular formula C30H36F3N5O5 and a molecular weight of 603.64 g/mol. Its IUPAC name is 8-methyl-2-[(4-methylphenyl)methyl]-1'-[(4-propan-2-yloxyphenyl)methyl]spiro[6H-imidazo[2,1-c][1,2,4]triazine-7,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 8-methyl-2-[(4-methylphenyl)methyl]-1'-[(4-propan-2-yloxyphenyl)methyl]spiro[6H-imidazo[2,1-c][1,2,4]triazine-7,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155840018 |
| Molecular Formula | C30H36F3N5O5 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | 8-methyl-2-[(4-methylphenyl)methyl]-1'-[(4-propan-2-yloxyphenyl)methyl]spiro[6H-imidazo[2,1-c][1,2,4]triazine-7,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(Cn2nc3n(c(=O)c2=O)CC2(CCN(Cc4ccc(OC(C)C)cc4)CC2)N3C)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H35N5O3.C2HF3O2/c1-20(2)36-24-11-9-22(10-12-24)17-31-15-13-28(14-16-31)19-32-25(34)26(35)33(29-27(32)30(28)4)18-23-7-5-21(3)6-8-23;3-2(4,5)1(6)7/h5-12,20H,13-19H2,1-4H3;(H,6,7) |
| InChIKey | ILYWLTCDHUCWBU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|