C20H30F3N5O4 — CID 155859314
1'-(cyclopropylmethyl)-8-methyl-2-(2-methylpropyl)spiro[6H-imidazo[2,1-c][1,2,4]triazine-7,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 155859314) has the molecular formula C20H30F3N5O4 and a molecular weight of 461.49 g/mol. Its IUPAC name is 1'-(cyclopropylmethyl)-8-methyl-2-(2-methylpropyl)spiro[6H-imidazo[2,1-c][1,2,4]triazine-7,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 1'-(cyclopropylmethyl)-8-methyl-2-(2-methylpropyl)spiro[6H-imidazo[2,1-c][1,2,4]triazine-7,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155859314 |
| Molecular Formula | C20H30F3N5O4 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 1'-(cyclopropylmethyl)-8-methyl-2-(2-methylpropyl)spiro[6H-imidazo[2,1-c][1,2,4]triazine-7,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)Cn1nc2n(c(=O)c1=O)CC1(CCN(CC3CC3)CC1)N2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H29N5O2.C2HF3O2/c1-13(2)10-23-16(25)15(24)22-12-18(20(3)17(22)19-23)6-8-21(9-7-18)11-14-4-5-14;3-2(4,5)1(6)7/h13-14H,4-12H2,1-3H3;(H,6,7) |
| InChIKey | NFRFKPPBLMFUAG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|