C27H36F3N5O5 — CID 155864291
2-(cyclobutylmethyl)-8-methyl-1'-[(4-propan-2-yloxyphenyl)methyl]spiro[6H-imidazo[2,1-c][1,2,4]triazine-7,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 155864291) has the molecular formula C27H36F3N5O5 and a molecular weight of 567.61 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-8-methyl-1'-[(4-propan-2-yloxyphenyl)methyl]spiro[6H-imidazo[2,1-c][1,2,4]triazine-7,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(cyclobutylmethyl)-8-methyl-1'-[(4-propan-2-yloxyphenyl)methyl]spiro[6H-imidazo[2,1-c][1,2,4]triazine-7,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155864291 |
| Molecular Formula | C27H36F3N5O5 |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 2-(cyclobutylmethyl)-8-methyl-1'-[(4-propan-2-yloxyphenyl)methyl]spiro[6H-imidazo[2,1-c][1,2,4]triazine-7,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)Oc1ccc(CN2CCC3(CC2)Cn2c(nn(CC4CCC4)c(=O)c2=O)N3C)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H35N5O3.C2HF3O2/c1-18(2)33-21-9-7-20(8-10-21)15-28-13-11-25(12-14-28)17-29-22(31)23(32)30(16-19-5-4-6-19)26-24(29)27(25)3;3-2(4,5)1(6)7/h7-10,18-19H,4-6,11-17H2,1-3H3;(H,6,7) |
| InChIKey | MFIZFVWNGXUYBM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|