C23H29F3N4O6 — CID 155827527
2-(cyclohexylmethyl)-1'-(furan-2-ylmethyl)spiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 155827527) has the molecular formula C23H29F3N4O6 and a molecular weight of 514.50 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-1'-(furan-2-ylmethyl)spiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(cyclohexylmethyl)-1'-(furan-2-ylmethyl)spiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827527 |
| Molecular Formula | C23H29F3N4O6 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 2-(cyclohexylmethyl)-1'-(furan-2-ylmethyl)spiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=c1c(=O)n2c(nn1CC1CCCCC1)COC1(CCN(Cc3ccco3)C1)C2 |
| InChI | InChI=1S/C21H28N4O4.C2HF3O2/c26-19-20(27)25(11-16-5-2-1-3-6-16)22-18-13-29-21(15-24(18)19)8-9-23(14-21)12-17-7-4-10-28-17;3-2(4,5)1(6)7/h4,7,10,16H,1-3,5-6,8-9,11-15H2;(H,6,7) |
| InChIKey | KFOQNJMISLBXKB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|