C16H18F3N5O5S — CID 155851994
2-methyl-1'-(1,3-thiazol-2-ylmethyl)spiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 155851994) has the molecular formula C16H18F3N5O5S and a molecular weight of 449.41 g/mol. Its IUPAC name is 2-methyl-1'-(1,3-thiazol-2-ylmethyl)spiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 2-methyl-1'-(1,3-thiazol-2-ylmethyl)spiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155851994 |
| Molecular Formula | C16H18F3N5O5S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 2-methyl-1'-(1,3-thiazol-2-ylmethyl)spiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | Cn1nc2n(c(=O)c1=O)CC1(CCN(Cc3nccs3)C1)OC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H17N5O3S.C2HF3O2/c1-17-12(20)13(21)19-9-14(22-7-10(19)16-17)2-4-18(8-14)6-11-15-3-5-23-11;3-2(4,5)1(6)7/h3,5H,2,4,6-9H2,1H3;(H,6,7) |
| InChIKey | XKPIERMRRMIDPD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|