C20H21F3N6O4S2 — CID 155847608
2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1'-(1,3-thiazol-2-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 155847608) has the molecular formula C20H21F3N6O4S2 and a molecular weight of 530.55 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1'-(1,3-thiazol-2-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1'-(1,3-thiazol-2-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155847608 |
| Molecular Formula | C20H21F3N6O4S2 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1'-(1,3-thiazol-2-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(Cn2nc3n(c(=O)c2=O)CCC32CCN(Cc3nccs3)C2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H20N6O2S2.C2HF3O2/c1-12-20-13(10-28-12)8-24-16(26)15(25)23-6-3-18(17(23)21-24)2-5-22(11-18)9-14-19-4-7-27-14;3-2(4,5)1(6)7/h4,7,10H,2-3,5-6,8-9,11H2,1H3;(H,6,7) |
| InChIKey | GXYYSSQUKXCLCN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|