C22H25N5O2S — CID 131672490
1'-[(3-methylphenyl)methyl]-2-[(2-methyl-1,3-thiazol-4-yl)methyl]spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione (PubChem CID 131672490) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is 1'-[(3-methylphenyl)methyl]-2-[(2-methyl-1,3-thiazol-4-yl)methyl]spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione.
| Compound Name | 1'-[(3-methylphenyl)methyl]-2-[(2-methyl-1,3-thiazol-4-yl)methyl]spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione |
|---|---|
| PubChem CID | 131672490 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1'-[(3-methylphenyl)methyl]-2-[(2-methyl-1,3-thiazol-4-yl)methyl]spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione |
| SMILES | Cc1cccc(CN2CCC3(CCn4c3nn(Cc3csc(C)n3)c(=O)c4=O)C2)c1 |
| InChI | InChI=1S/C22H25N5O2S/c1-15-4-3-5-17(10-15)11-25-8-6-22(14-25)7-9-26-19(28)20(29)27(24-21(22)26)12-18-13-30-16(2)23-18/h3-5,10,13H,6-9,11-12,14H2,1-2H3 |
| InChIKey | OSGGDCUMXZOMAZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|