C24H27N5O2 — CID 131669940
1'-[(3,5-dimethylphenyl)methyl]-2-(pyridin-2-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione (PubChem CID 131669940) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1'-[(3,5-dimethylphenyl)methyl]-2-(pyridin-2-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione.
| Compound Name | 1'-[(3,5-dimethylphenyl)methyl]-2-(pyridin-2-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione |
|---|---|
| PubChem CID | 131669940 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 1'-[(3,5-dimethylphenyl)methyl]-2-(pyridin-2-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione |
| SMILES | Cc1cc(C)cc(CN2CCC3(CCn4c3nn(Cc3ccccn3)c(=O)c4=O)C2)c1 |
| InChI | InChI=1S/C24H27N5O2/c1-17-11-18(2)13-19(12-17)14-27-9-6-24(16-27)7-10-28-21(30)22(31)29(26-23(24)28)15-20-5-3-4-8-25-20/h3-5,8,11-13H,6-7,9-10,14-16H2,1-2H3 |
| InChIKey | WPDYFELKWIKOSL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|