C24H23F6N5O6S — CID 155830655
1'-(pyridin-3-ylmethyl)-2-(thiophen-2-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155830655) has the molecular formula C24H23F6N5O6S and a molecular weight of 623.53 g/mol. Its IUPAC name is 1'-(pyridin-3-ylmethyl)-2-(thiophen-2-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1'-(pyridin-3-ylmethyl)-2-(thiophen-2-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155830655 |
| Molecular Formula | C24H23F6N5O6S |
| Molecular Weight | 623.53 g/mol |
| Exact Mass | 623.13 |
| IUPAC Name | 1'-(pyridin-3-ylmethyl)-2-(thiophen-2-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=c1c(=O)n2c(nn1Cc1cccs1)C1(CCN(Cc3cccnc3)C1)CC2 |
| InChI | InChI=1S/C20H21N5O2S.2C2HF3O2/c26-17-18(27)25(13-16-4-2-10-28-16)22-19-20(6-9-24(17)19)5-8-23(14-20)12-15-3-1-7-21-11-15;2*3-2(4,5)1(6)7/h1-4,7,10-11H,5-6,8-9,12-14H2;2*(H,6,7) |
| InChIKey | CDAVMUMJFVGOBN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|