C24H25F3N4O4S — CID 155851162
2-benzyl-1'-(thiophen-3-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 155851162) has the molecular formula C24H25F3N4O4S and a molecular weight of 522.55 g/mol. Its IUPAC name is 2-benzyl-1'-(thiophen-3-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 2-benzyl-1'-(thiophen-3-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155851162 |
| Molecular Formula | C24H25F3N4O4S |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 2-benzyl-1'-(thiophen-3-ylmethyl)spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,4'-piperidine]-3,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=c1c(=O)n2c(nn1Cc1ccccc1)C1(CCN(Cc3ccsc3)CC1)CC2 |
| InChI | InChI=1S/C22H24N4O2S.C2HF3O2/c27-19-20(28)26(15-17-4-2-1-3-5-17)23-21-22(9-12-25(19)21)7-10-24(11-8-22)14-18-6-13-29-16-18;3-2(4,5)1(6)7/h1-6,13,16H,7-12,14-15H2;(H,6,7) |
| InChIKey | UOHDGWKBRSNCQO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|