C22H24F4N4O4 — CID 155828031
11-(cyclobutylmethyl)-4-[(3-fluorophenyl)methyl]-4,8,11,12-tetrazatricyclo[6.4.0.02,6]dodec-1(12)-ene-9,10-dione;2,2,2-trifluoroacetic acid (PubChem CID 155828031) has the molecular formula C22H24F4N4O4 and a molecular weight of 484.45 g/mol. Its IUPAC name is 11-(cyclobutylmethyl)-4-[(3-fluorophenyl)methyl]-4,8,11,12-tetrazatricyclo[6.4.0.02,6]dodec-1(12)-ene-9,10-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 11-(cyclobutylmethyl)-4-[(3-fluorophenyl)methyl]-4,8,11,12-tetrazatricyclo[6.4.0.02,6]dodec-1(12)-ene-9,10-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828031 |
| Molecular Formula | C22H24F4N4O4 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 11-(cyclobutylmethyl)-4-[(3-fluorophenyl)methyl]-4,8,11,12-tetrazatricyclo[6.4.0.02,6]dodec-1(12)-ene-9,10-dione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=c1c(=O)n2c(nn1CC1CCC1)C1CN(Cc3cccc(F)c3)CC1C2 |
| InChI | InChI=1S/C20H23FN4O2.C2HF3O2/c21-16-6-2-5-14(7-16)8-23-10-15-11-24-18(17(15)12-23)22-25(20(27)19(24)26)9-13-3-1-4-13;3-2(4,5)1(6)7/h2,5-7,13,15,17H,1,3-4,8-12H2;(H,6,7) |
| InChIKey | ZIVSCDOTATXZHP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|