C20H29NO2 — CID 167224628
propyl 2-benzyl-2-azaspiro[4.5]decane-4-carboxylate (PubChem CID 167224628) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is propyl 2-benzyl-2-azaspiro[4.5]decane-4-carboxylate.
| Compound Name | propyl 2-benzyl-2-azaspiro[4.5]decane-4-carboxylate |
|---|---|
| PubChem CID | 167224628 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | propyl 2-benzyl-2-azaspiro[4.5]decane-4-carboxylate |
| SMILES | CCCOC(=O)C1CN(Cc2ccccc2)CC12CCCCC2 |
| InChI | InChI=1S/C20H29NO2/c1-2-13-23-19(22)18-15-21(14-17-9-5-3-6-10-17)16-20(18)11-7-4-8-12-20/h3,5-6,9-10,18H,2,4,7-8,11-16H2,1H3 |
| InChIKey | VHZHBZQXVMBOJV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |