C15H19F2NO2 — CID 124709143
ethyl (4R)-1-benzyl-3,3-difluoropiperidine-4-carboxylate (PubChem CID 124709143) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is ethyl (4R)-1-benzyl-3,3-difluoropiperidine-4-carboxylate.
| Compound Name | ethyl (4R)-1-benzyl-3,3-difluoropiperidine-4-carboxylate |
|---|---|
| PubChem CID | 124709143 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | ethyl (4R)-1-benzyl-3,3-difluoropiperidine-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCN(Cc2ccccc2)CC1(F)F |
| InChI | InChI=1S/C15H19F2NO2/c1-2-20-14(19)13-8-9-18(11-15(13,16)17)10-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3/t13-/m1/s1 |
| InChIKey | HFKGACYIZJLSHM-CYBMUJFWSA-N |
| XLogP | 2.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |