C20H30N2O2 — CID 2846487
ethyl 1-(1-benzylpiperidin-4-yl)piperidine-2-carboxylate (PubChem CID 2846487) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is ethyl 1-(1-benzylpiperidin-4-yl)piperidine-2-carboxylate.
| Compound Name | ethyl 1-(1-benzylpiperidin-4-yl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 2846487 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | ethyl 1-(1-benzylpiperidin-4-yl)piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H30N2O2/c1-2-24-20(23)19-10-6-7-13-22(19)18-11-14-21(15-12-18)16-17-8-4-3-5-9-17/h3-5,8-9,18-19H,2,6-7,10-16H2,1H3 |
| InChIKey | LCIYMEUAPNBEJH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |