C20H29NO2 — CID 784294
ethyl (2R)-1-(4-phenylcyclohexyl)piperidine-2-carboxylate (PubChem CID 784294) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is ethyl (2R)-1-(4-phenylcyclohexyl)piperidine-2-carboxylate.
| Compound Name | ethyl (2R)-1-(4-phenylcyclohexyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 784294 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | ethyl (2R)-1-(4-phenylcyclohexyl)piperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCCN1C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H29NO2/c1-2-23-20(22)19-10-6-7-15-21(19)18-13-11-17(12-14-18)16-8-4-3-5-9-16/h3-5,8-9,17-19H,2,6-7,10-15H2,1H3/t17?,18?,19-/m1/s1 |
| InChIKey | UQNZQQKNENFRRR-CTWPCTMYSA-N |
| XLogP | 4.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |