C15H22ClNO3 — CID 165176370
ethyl 1-benzyl-4-hydroxypiperidine-3-carboxylate;hydrochloride (PubChem CID 165176370) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is ethyl 1-benzyl-4-hydroxypiperidine-3-carboxylate;hydrochloride.
| Compound Name | ethyl 1-benzyl-4-hydroxypiperidine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 165176370 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | ethyl 1-benzyl-4-hydroxypiperidine-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1CN(Cc2ccccc2)CCC1O.Cl |
| InChI | InChI=1S/C15H21NO3.ClH/c1-2-19-15(18)13-11-16(9-8-14(13)17)10-12-6-4-3-5-7-12;/h3-7,13-14,17H,2,8-11H2,1H3;1H |
| InChIKey | WVYFKTWPWPLTRM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |