C13H16NNaO3 — CID 68688042
sodium (3S,4R)-1-benzyl-4-hydroxypiperidine-3-carboxylate (PubChem CID 68688042) has the molecular formula C13H16NNaO3 and a molecular weight of 257.26 g/mol. Its IUPAC name is sodium (3S,4R)-1-benzyl-4-hydroxypiperidine-3-carboxylate.
| Compound Name | sodium (3S,4R)-1-benzyl-4-hydroxypiperidine-3-carboxylate |
|---|---|
| PubChem CID | 68688042 |
| Molecular Formula | C13H16NNaO3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | sodium (3S,4R)-1-benzyl-4-hydroxypiperidine-3-carboxylate |
| SMILES | O=C([O-])[C@H]1CN(Cc2ccccc2)CC[C@H]1O.[Na+] |
| InChI | InChI=1S/C13H17NO3.Na/c15-12-6-7-14(9-11(12)13(16)17)8-10-4-2-1-3-5-10;/h1-5,11-12,15H,6-9H2,(H,16,17);/q;+1/p-1/t11-,12+;/m0./s1 |
| InChIKey | RFHKKTYVPVBZMC-ZVWHLABXSA-M |
| XLogP | -3.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |