C21H31N3O2 — CID 119895647
(1-benzyl-1,4-diazaspiro[5.5]undecan-4-yl)-morpholin-2-ylmethanone (PubChem CID 119895647) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is (1-benzyl-1,4-diazaspiro[5.5]undecan-4-yl)-morpholin-2-ylmethanone.
| Compound Name | (1-benzyl-1,4-diazaspiro[5.5]undecan-4-yl)-morpholin-2-ylmethanone |
|---|---|
| PubChem CID | 119895647 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | (1-benzyl-1,4-diazaspiro[5.5]undecan-4-yl)-morpholin-2-ylmethanone |
| SMILES | O=C(C1CNCCO1)N1CCN(Cc2ccccc2)C2(CCCCC2)C1 |
| InChI | InChI=1S/C21H31N3O2/c25-20(19-15-22-11-14-26-19)23-12-13-24(16-18-7-3-1-4-8-18)21(17-23)9-5-2-6-10-21/h1,3-4,7-8,19,22H,2,5-6,9-17H2 |
| InChIKey | FIPKXGSFKOYVMZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |