C12H13F3N2O — CID 12678600
1-[[3-(trifluoromethyl)phenyl]methyl]-1,3-diazinan-2-one (PubChem CID 12678600) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is 1-[[3-(trifluoromethyl)phenyl]methyl]-1,3-diazinan-2-one.
| Compound Name | 1-[[3-(trifluoromethyl)phenyl]methyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 12678600 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-[[3-(trifluoromethyl)phenyl]methyl]-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2O/c13-12(14,15)10-4-1-3-9(7-10)8-17-6-2-5-16-11(17)18/h1,3-4,7H,2,5-6,8H2,(H,16,18) |
| InChIKey | FGZBEJAZYHUDBZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |