C13H15F3N2O — CID 65362122
1-[[3-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-2-one (PubChem CID 65362122) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is 1-[[3-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-2-one.
| Compound Name | 1-[[3-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65362122 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 1-[[3-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-2-one |
| SMILES | O=C1CNCCCN1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O/c14-13(15,16)11-4-1-3-10(7-11)9-18-6-2-5-17-8-12(18)19/h1,3-4,7,17H,2,5-6,8-9H2 |
| InChIKey | XKUUKLHEJBXLOL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |