C12H12ClF3N2O — CID 154734264
1-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]piperazin-2-one (PubChem CID 154734264) has the molecular formula C12H12ClF3N2O and a molecular weight of 292.69 g/mol. Its IUPAC name is 1-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]piperazin-2-one.
| Compound Name | 1-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 154734264 |
| Molecular Formula | C12H12ClF3N2O |
| Molecular Weight | 292.69 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]piperazin-2-one |
| SMILES | O=C1CNCCN1Cc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C12H12ClF3N2O/c13-10-2-1-9(12(14,15)16)5-8(10)7-18-4-3-17-6-11(18)19/h1-2,5,17H,3-4,6-7H2 |
| InChIKey | ORACPYWOQJOAGD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.69 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |