C12H14BrClN2O — CID 113471437
1-[(4-bromo-2-chlorophenyl)methyl]-1,4-diazepan-2-one (PubChem CID 113471437) has the molecular formula C12H14BrClN2O and a molecular weight of 317.61 g/mol. Its IUPAC name is 1-[(4-bromo-2-chlorophenyl)methyl]-1,4-diazepan-2-one.
| Compound Name | 1-[(4-bromo-2-chlorophenyl)methyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 113471437 |
| Molecular Formula | C12H14BrClN2O |
| Molecular Weight | 317.61 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 1-[(4-bromo-2-chlorophenyl)methyl]-1,4-diazepan-2-one |
| SMILES | O=C1CNCCCN1Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H14BrClN2O/c13-10-3-2-9(11(14)6-10)8-16-5-1-4-15-7-12(16)17/h2-3,6,15H,1,4-5,7-8H2 |
| InChIKey | LMEPYYGZFOBKMU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.61 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |