C12H14F2N2O — CID 105407900
1-[(3,5-difluorophenyl)methyl]-1,4-diazepan-2-one (PubChem CID 105407900) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-1,4-diazepan-2-one.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 105407900 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-1,4-diazepan-2-one |
| SMILES | O=C1CNCCCN1Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H14F2N2O/c13-10-4-9(5-11(14)6-10)8-16-3-1-2-15-7-12(16)17/h4-6,15H,1-3,7-8H2 |
| InChIKey | FETJUVGBJQKWOM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |