C13H18N2O2 — CID 113365948
1-[[4-(hydroxymethyl)phenyl]methyl]-1,4-diazepan-2-one (PubChem CID 113365948) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-[[4-(hydroxymethyl)phenyl]methyl]-1,4-diazepan-2-one.
| Compound Name | 1-[[4-(hydroxymethyl)phenyl]methyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 113365948 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-[[4-(hydroxymethyl)phenyl]methyl]-1,4-diazepan-2-one |
| SMILES | O=C1CNCCCN1Cc1ccc(CO)cc1 |
| InChI | InChI=1S/C13H18N2O2/c16-10-12-4-2-11(3-5-12)9-15-7-1-6-14-8-13(15)17/h2-5,14,16H,1,6-10H2 |
| InChIKey | IUQMVXJDGLGTBZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |