C13H16FN3O2 — CID 65362331
3-fluoro-4-[(2-oxo-1,4-diazepan-1-yl)methyl]benzamide (PubChem CID 65362331) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is 3-fluoro-4-[(2-oxo-1,4-diazepan-1-yl)methyl]benzamide.
| Compound Name | 3-fluoro-4-[(2-oxo-1,4-diazepan-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 65362331 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 3-fluoro-4-[(2-oxo-1,4-diazepan-1-yl)methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN2CCCNCC2=O)c(F)c1 |
| InChI | InChI=1S/C13H16FN3O2/c14-11-6-9(13(15)19)2-3-10(11)8-17-5-1-4-16-7-12(17)18/h2-3,6,16H,1,4-5,7-8H2,(H2,15,19) |
| InChIKey | HDVZVBGJSBYMLG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |