C13H18FN3O — CID 65449051
3-fluoro-4-[(3-methylpiperazin-1-yl)methyl]benzamide (PubChem CID 65449051) has the molecular formula C13H18FN3O and a molecular weight of 251.30 g/mol. Its IUPAC name is 3-fluoro-4-[(3-methylpiperazin-1-yl)methyl]benzamide.
| Compound Name | 3-fluoro-4-[(3-methylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 65449051 |
| Molecular Formula | C13H18FN3O |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-fluoro-4-[(3-methylpiperazin-1-yl)methyl]benzamide |
| SMILES | CC1CN(Cc2ccc(C(N)=O)cc2F)CCN1 |
| InChI | InChI=1S/C13H18FN3O/c1-9-7-17(5-4-16-9)8-11-3-2-10(13(15)18)6-12(11)14/h2-3,6,9,16H,4-5,7-8H2,1H3,(H2,15,18) |
| InChIKey | SCIPNJSRTGTYDN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |