C15H21FN4O — CID 66196185
3-fluoro-4-[(3-piperazin-1-ylazetidin-1-yl)methyl]benzamide (PubChem CID 66196185) has the molecular formula C15H21FN4O and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-fluoro-4-[(3-piperazin-1-ylazetidin-1-yl)methyl]benzamide.
| Compound Name | 3-fluoro-4-[(3-piperazin-1-ylazetidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 66196185 |
| Molecular Formula | C15H21FN4O |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3-fluoro-4-[(3-piperazin-1-ylazetidin-1-yl)methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN2CC(N3CCNCC3)C2)c(F)c1 |
| InChI | InChI=1S/C15H21FN4O/c16-14-7-11(15(17)21)1-2-12(14)8-19-9-13(10-19)20-5-3-18-4-6-20/h1-2,7,13,18H,3-6,8-10H2,(H2,17,21) |
| InChIKey | IYJFPNIEOMZKCS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |