C14H19F2N3 — CID 66203000
1-[1-[(2,4-difluorophenyl)methyl]azetidin-3-yl]piperazine (PubChem CID 66203000) has the molecular formula C14H19F2N3 and a molecular weight of 267.32 g/mol. Its IUPAC name is 1-[1-[(2,4-difluorophenyl)methyl]azetidin-3-yl]piperazine.
| Compound Name | 1-[1-[(2,4-difluorophenyl)methyl]azetidin-3-yl]piperazine |
|---|---|
| PubChem CID | 66203000 |
| Molecular Formula | C14H19F2N3 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1-[1-[(2,4-difluorophenyl)methyl]azetidin-3-yl]piperazine |
| SMILES | Fc1ccc(CN2CC(N3CCNCC3)C2)c(F)c1 |
| InChI | InChI=1S/C14H19F2N3/c15-12-2-1-11(14(16)7-12)8-18-9-13(10-18)19-5-3-17-4-6-19/h1-2,7,13,17H,3-6,8-10H2 |
| InChIKey | IENOJRKILZIWLR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |