C14H18F3N3 — CID 66202797
1-[1-[(3,4,5-trifluorophenyl)methyl]azetidin-3-yl]piperazine (PubChem CID 66202797) has the molecular formula C14H18F3N3 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-[1-[(3,4,5-trifluorophenyl)methyl]azetidin-3-yl]piperazine.
| Compound Name | 1-[1-[(3,4,5-trifluorophenyl)methyl]azetidin-3-yl]piperazine |
|---|---|
| PubChem CID | 66202797 |
| Molecular Formula | C14H18F3N3 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-[1-[(3,4,5-trifluorophenyl)methyl]azetidin-3-yl]piperazine |
| SMILES | Fc1cc(CN2CC(N3CCNCC3)C2)cc(F)c1F |
| InChI | InChI=1S/C14H18F3N3/c15-12-5-10(6-13(16)14(12)17)7-19-8-11(9-19)20-3-1-18-2-4-20/h5-6,11,18H,1-4,7-9H2 |
| InChIKey | KTBQPXJPZOMVMY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|