C15H20ClF3N2 — CID 120906720
2-[(3,4,5-trifluorophenyl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride (PubChem CID 120906720) has the molecular formula C15H20ClF3N2 and a molecular weight of 320.79 g/mol. Its IUPAC name is 2-[(3,4,5-trifluorophenyl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride.
| Compound Name | 2-[(3,4,5-trifluorophenyl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride |
|---|---|
| PubChem CID | 120906720 |
| Molecular Formula | C15H20ClF3N2 |
| Molecular Weight | 320.79 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[(3,4,5-trifluorophenyl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride |
| SMILES | Cl.Fc1cc(CN2CCC3(CCNCC3)C2)cc(F)c1F |
| InChI | InChI=1S/C15H19F3N2.ClH/c16-12-7-11(8-13(17)14(12)18)9-20-6-3-15(10-20)1-4-19-5-2-15;/h7-8,19H,1-6,9-10H2;1H |
| InChIKey | GVPYIELCYLENJV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.79 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|