C14H19ClFN3 — CID 81154667
1-[1-[(3-chloro-4-fluorophenyl)methyl]azetidin-3-yl]piperazine (PubChem CID 81154667) has the molecular formula C14H19ClFN3 and a molecular weight of 283.78 g/mol. Its IUPAC name is 1-[1-[(3-chloro-4-fluorophenyl)methyl]azetidin-3-yl]piperazine.
| Compound Name | 1-[1-[(3-chloro-4-fluorophenyl)methyl]azetidin-3-yl]piperazine |
|---|---|
| PubChem CID | 81154667 |
| Molecular Formula | C14H19ClFN3 |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 1-[1-[(3-chloro-4-fluorophenyl)methyl]azetidin-3-yl]piperazine |
| SMILES | Fc1ccc(CN2CC(N3CCNCC3)C2)cc1Cl |
| InChI | InChI=1S/C14H19ClFN3/c15-13-7-11(1-2-14(13)16)8-18-9-12(10-18)19-5-3-17-4-6-19/h1-2,7,12,17H,3-6,8-10H2 |
| InChIKey | KPJWTIHTLBLEHM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |