C10H11ClFN — CID 126990716
1-[(3-chloro-4-fluorophenyl)methyl]azetidine (PubChem CID 126990716) has the molecular formula C10H11ClFN and a molecular weight of 199.66 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]azetidine.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]azetidine |
|---|---|
| PubChem CID | 126990716 |
| Molecular Formula | C10H11ClFN |
| Molecular Weight | 199.66 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]azetidine |
| SMILES | Fc1ccc(CN2CCC2)cc1Cl |
| InChI | InChI=1S/C10H11ClFN/c11-9-6-8(2-3-10(9)12)7-13-4-1-5-13/h2-3,6H,1,4-5,7H2 |
| InChIKey | MEIAFVIBBRSSKQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.66 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |