C13H16ClFN2S — CID 103038018
1-[(3-chloro-4-fluorophenyl)methyl]piperidine-4-carbothioamide (PubChem CID 103038018) has the molecular formula C13H16ClFN2S and a molecular weight of 286.80 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]piperidine-4-carbothioamide.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]piperidine-4-carbothioamide |
|---|---|
| PubChem CID | 103038018 |
| Molecular Formula | C13H16ClFN2S |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]piperidine-4-carbothioamide |
| SMILES | NC(=S)C1CCN(Cc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H16ClFN2S/c14-11-7-9(1-2-12(11)15)8-17-5-3-10(4-6-17)13(16)18/h1-2,7,10H,3-6,8H2,(H2,16,18) |
| InChIKey | VRDUXIZTJATDIH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|