C14H19Cl2FN2 — CID 103041322
1-(2-chloroethyl)-4-[(3-chloro-4-fluorophenyl)methyl]-1,4-diazepane (PubChem CID 103041322) has the molecular formula C14H19Cl2FN2 and a molecular weight of 305.22 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-[(3-chloro-4-fluorophenyl)methyl]-1,4-diazepane.
| Compound Name | 1-(2-chloroethyl)-4-[(3-chloro-4-fluorophenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 103041322 |
| Molecular Formula | C14H19Cl2FN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-(2-chloroethyl)-4-[(3-chloro-4-fluorophenyl)methyl]-1,4-diazepane |
| SMILES | Fc1ccc(CN2CCCN(CCCl)CC2)cc1Cl |
| InChI | InChI=1S/C14H19Cl2FN2/c15-4-7-18-5-1-6-19(9-8-18)11-12-2-3-14(17)13(16)10-12/h2-3,10H,1,4-9,11H2 |
| InChIKey | AWOVLHPIEAASKW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|