C13H18ClFN2 — CID 82482788
1-[2-(3-chloro-4-fluorophenyl)ethyl]-1,4-diazepane (PubChem CID 82482788) has the molecular formula C13H18ClFN2 and a molecular weight of 256.75 g/mol. Its IUPAC name is 1-[2-(3-chloro-4-fluorophenyl)ethyl]-1,4-diazepane.
| Compound Name | 1-[2-(3-chloro-4-fluorophenyl)ethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 82482788 |
| Molecular Formula | C13H18ClFN2 |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-[2-(3-chloro-4-fluorophenyl)ethyl]-1,4-diazepane |
| SMILES | Fc1ccc(CCN2CCCNCC2)cc1Cl |
| InChI | InChI=1S/C13H18ClFN2/c14-12-10-11(2-3-13(12)15)4-8-17-7-1-5-16-6-9-17/h2-3,10,16H,1,4-9H2 |
| InChIKey | DSQVOMQTRHVZDI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |