C14H22N2 — CID 82079414
1-[2-(4-methylphenyl)ethyl]-1,4-diazepane (PubChem CID 82079414) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-[2-(4-methylphenyl)ethyl]-1,4-diazepane.
| Compound Name | 1-[2-(4-methylphenyl)ethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 82079414 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-[2-(4-methylphenyl)ethyl]-1,4-diazepane |
| SMILES | Cc1ccc(CCN2CCCNCC2)cc1 |
| InChI | InChI=1S/C14H22N2/c1-13-3-5-14(6-4-13)7-11-16-10-2-8-15-9-12-16/h3-6,15H,2,7-12H2,1H3 |
| InChIKey | APGIRYXQBIINQD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |