C18H32N4 — CID 14869439
1-(2-phenylethyl)-1,4,8,11-tetrazacyclotetradecane (PubChem CID 14869439) has the molecular formula C18H32N4 and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-(2-phenylethyl)-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 1-(2-phenylethyl)-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 14869439 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 1-(2-phenylethyl)-1,4,8,11-tetrazacyclotetradecane |
| SMILES | c1ccc(CCN2CCCNCCNCCCNCC2)cc1 |
| InChI | InChI=1S/C18H32N4/c1-2-6-18(7-3-1)8-16-22-15-5-11-20-13-12-19-9-4-10-21-14-17-22/h1-3,6-7,19-21H,4-5,8-17H2 |
| InChIKey | KSWGDSOCSBLXRE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |