C14H23N3 — CID 62833127
N-benzyl-2-(1,4-diazepan-1-yl)ethanamine (PubChem CID 62833127) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is N-benzyl-2-(1,4-diazepan-1-yl)ethanamine.
| Compound Name | N-benzyl-2-(1,4-diazepan-1-yl)ethanamine |
|---|---|
| PubChem CID | 62833127 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | N-benzyl-2-(1,4-diazepan-1-yl)ethanamine |
| SMILES | c1ccc(CNCCN2CCCNCC2)cc1 |
| InChI | InChI=1S/C14H23N3/c1-2-5-14(6-3-1)13-16-9-12-17-10-4-7-15-8-11-17/h1-3,5-6,15-16H,4,7-13H2 |
| InChIKey | ZVIRMXMAEJPTAR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|