C15H22F3N3 — CID 62575078
N-benzyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanamine (PubChem CID 62575078) has the molecular formula C15H22F3N3 and a molecular weight of 301.36 g/mol. Its IUPAC name is N-benzyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanamine.
| Compound Name | N-benzyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 62575078 |
| Molecular Formula | C15H22F3N3 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-benzyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanamine |
| SMILES | FC(F)(F)CN1CCN(CCNCc2ccccc2)CC1 |
| InChI | InChI=1S/C15H22F3N3/c16-15(17,18)13-21-10-8-20(9-11-21)7-6-19-12-14-4-2-1-3-5-14/h1-5,19H,6-13H2 |
| InChIKey | IYWWHMBHTUGXRZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|