C12H24F3N3 — CID 62575111
2-methyl-N-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]propan-1-amine (PubChem CID 62575111) has the molecular formula C12H24F3N3 and a molecular weight of 267.34 g/mol. Its IUPAC name is 2-methyl-N-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]propan-1-amine.
| Compound Name | 2-methyl-N-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 62575111 |
| Molecular Formula | C12H24F3N3 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 2-methyl-N-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]propan-1-amine |
| SMILES | CC(C)CNCCN1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H24F3N3/c1-11(2)9-16-3-4-17-5-7-18(8-6-17)10-12(13,14)15/h11,16H,3-10H2,1-2H3 |
| InChIKey | ZDUONJHQXQTLSN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|