C14H28F3N3 — CID 62557137
3-methyl-N-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]butan-1-amine (PubChem CID 62557137) has the molecular formula C14H28F3N3 and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-methyl-N-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]butan-1-amine.
| Compound Name | 3-methyl-N-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]butan-1-amine |
|---|---|
| PubChem CID | 62557137 |
| Molecular Formula | C14H28F3N3 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.22 |
| IUPAC Name | 3-methyl-N-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]butan-1-amine |
| SMILES | CC(C)CCNCC(C)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H28F3N3/c1-12(2)4-5-18-10-13(3)20-8-6-19(7-9-20)11-14(15,16)17/h12-13,18H,4-11H2,1-3H3 |
| InChIKey | VVGFXZLGDBSUQC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|