C14H22F3N3S — CID 62575243
N-[(3-methylthiophen-2-yl)methyl]-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanamine (PubChem CID 62575243) has the molecular formula C14H22F3N3S and a molecular weight of 321.41 g/mol. Its IUPAC name is N-[(3-methylthiophen-2-yl)methyl]-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanamine.
| Compound Name | N-[(3-methylthiophen-2-yl)methyl]-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 62575243 |
| Molecular Formula | C14H22F3N3S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-[(3-methylthiophen-2-yl)methyl]-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanamine |
| SMILES | Cc1ccsc1CNCCN1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H22F3N3S/c1-12-2-9-21-13(12)10-18-3-4-19-5-7-20(8-6-19)11-14(15,16)17/h2,9,18H,3-8,10-11H2,1H3 |
| InChIKey | WDKBNUMWQNRPIG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|