C16H27N3 — CID 63209215
N-benzyl-N'-methyl-N'-(2-pyrrolidin-1-ylethyl)ethane-1,2-diamine (PubChem CID 63209215) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is N-benzyl-N'-methyl-N'-(2-pyrrolidin-1-ylethyl)ethane-1,2-diamine.
| Compound Name | N-benzyl-N'-methyl-N'-(2-pyrrolidin-1-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63209215 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | N-benzyl-N'-methyl-N'-(2-pyrrolidin-1-ylethyl)ethane-1,2-diamine |
| SMILES | CN(CCNCc1ccccc1)CCN1CCCC1 |
| InChI | InChI=1S/C16H27N3/c1-18(13-14-19-10-5-6-11-19)12-9-17-15-16-7-3-2-4-8-16/h2-4,7-8,17H,5-6,9-15H2,1H3 |
| InChIKey | GCSVECGTVKWEKB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|