C18H31N5O2 — CID 71182294
1-[2-(4-nitrophenyl)ethyl]-1,4,8,11-tetrazacyclotetradecane (PubChem CID 71182294) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-[2-(4-nitrophenyl)ethyl]-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 1-[2-(4-nitrophenyl)ethyl]-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 71182294 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 1-[2-(4-nitrophenyl)ethyl]-1,4,8,11-tetrazacyclotetradecane |
| SMILES | O=[N+]([O-])c1ccc(CCN2CCCNCCNCCCNCC2)cc1 |
| InChI | InChI=1S/C18H31N5O2/c24-23(25)18-5-3-17(4-6-18)7-15-22-14-2-10-20-12-11-19-8-1-9-21-13-16-22/h3-6,19-21H,1-2,7-16H2 |
| InChIKey | DNEIKAFWTMODAG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|