C18H34N6 — CID 15294221
4-[2-(1,4,7,10,13-pentazacyclopentadec-1-yl)ethyl]aniline (PubChem CID 15294221) has the molecular formula C18H34N6 and a molecular weight of 334.51 g/mol. Its IUPAC name is 4-[2-(1,4,7,10,13-pentazacyclopentadec-1-yl)ethyl]aniline.
| Compound Name | 4-[2-(1,4,7,10,13-pentazacyclopentadec-1-yl)ethyl]aniline |
|---|---|
| PubChem CID | 15294221 |
| Molecular Formula | C18H34N6 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.28 |
| IUPAC Name | 4-[2-(1,4,7,10,13-pentazacyclopentadec-1-yl)ethyl]aniline |
| SMILES | Nc1ccc(CCN2CCNCCNCCNCCNCC2)cc1 |
| InChI | InChI=1S/C18H34N6/c19-18-3-1-17(2-4-18)5-14-24-15-12-22-10-8-20-6-7-21-9-11-23-13-16-24/h1-4,20-23H,5-16,19H2 |
| InChIKey | LUPRIYJPUIUQKY-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|