C20H33N5O4 — CID 89349171
2-[4-[2-(4-aminophenyl)ethyl]-7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 89349171) has the molecular formula C20H33N5O4 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-[4-[2-(4-aminophenyl)ethyl]-7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[2-(4-aminophenyl)ethyl]-7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 89349171 |
| Molecular Formula | C20H33N5O4 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 2-[4-[2-(4-aminophenyl)ethyl]-7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | Nc1ccc(CCN2CCN(CC(=O)O)CCNCCN(CC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C20H33N5O4/c21-18-3-1-17(2-4-18)5-8-23-11-13-24(15-19(26)27)9-6-22-7-10-25(14-12-23)16-20(28)29/h1-4,22H,5-16,21H2,(H,26,27)(H,28,29) |
| InChIKey | BXMMAYLEDXGNIT-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|